C26H32N2O6 — CID 131676597
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)heptanoic acid;prop-2-enyl carbamate (PubChem CID 131676597) has the molecular formula C26H32N2O6 and a molecular weight of 468.55 g/mol. Its IUPAC name is (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)heptanoic acid;prop-2-enyl carbamate.
| Compound Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)heptanoic acid;prop-2-enyl carbamate |
|---|---|
| PubChem CID | 131676597 |
| Molecular Formula | C26H32N2O6 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)heptanoic acid;prop-2-enyl carbamate |
| SMILES | C=CCOC(N)=O.CCCCC[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C22H25NO4.C4H7NO2/c1-2-3-4-13-20(21(24)25)23-22(26)27-14-19-17-11-7-5-9-15(17)16-10-6-8-12-18(16)19;1-2-3-7-4(5)6/h5-12,19-20H,2-4,13-14H2,1H3,(H,23,26)(H,24,25);2H,1,3H2,(H2,5,6)/t20-;/m1./s1 |
| InChIKey | MAXRRVIKOXEBOL-VEIFNGETSA-N |
| XLogP | 4.83 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|