C20H19NO4 — CID 4052587
2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid (PubChem CID 4052587) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid |
|---|---|
| PubChem CID | 4052587 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid |
| SMILES | C=CCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C20H19NO4/c1-2-7-18(19(22)23)21-20(24)25-12-17-15-10-5-3-8-13(15)14-9-4-6-11-16(14)17/h2-6,8-11,17-18H,1,7,12H2,(H,21,24)(H,22,23) |
| InChIKey | YVBLQCANYSFEBN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|