C27H25NO4 — CID 102217159
benzyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoate (PubChem CID 102217159) has the molecular formula C27H25NO4 and a molecular weight of 427.50 g/mol. Its IUPAC name is benzyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoate.
| Compound Name | benzyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoate |
|---|---|
| PubChem CID | 102217159 |
| Molecular Formula | C27H25NO4 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | benzyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoate |
| SMILES | C=CC[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H25NO4/c1-2-10-25(26(29)31-17-19-11-4-3-5-12-19)28-27(30)32-18-24-22-15-8-6-13-20(22)21-14-7-9-16-23(21)24/h2-9,11-16,24-25H,1,10,17-18H2,(H,28,30)/t25-/m1/s1 |
| InChIKey | NTOCLTIRCOQHPW-RUZDIDTESA-N |
| XLogP | 5.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|