C38H34N2O8 — CID 57135941
(2S,7S)-2,7-bis(9H-fluoren-9-ylmethoxycarbonylamino)oct-4-enedioic acid (PubChem CID 57135941) has the molecular formula C38H34N2O8 and a molecular weight of 646.70 g/mol. Its IUPAC name is (2S,7S)-2,7-bis(9H-fluoren-9-ylmethoxycarbonylamino)oct-4-enedioic acid.
| Compound Name | (2S,7S)-2,7-bis(9H-fluoren-9-ylmethoxycarbonylamino)oct-4-enedioic acid |
|---|---|
| PubChem CID | 57135941 |
| Molecular Formula | C38H34N2O8 |
| Molecular Weight | 646.70 g/mol |
| Exact Mass | 646.23 |
| IUPAC Name | (2S,7S)-2,7-bis(9H-fluoren-9-ylmethoxycarbonylamino)oct-4-enedioic acid |
| SMILES | O=C(N[C@@H](CC=CC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C38H34N2O8/c41-35(42)33(39-37(45)47-21-31-27-15-5-1-11-23(27)24-12-2-6-16-28(24)31)19-9-10-20-34(36(43)44)40-38(46)48-22-32-29-17-7-3-13-25(29)26-14-4-8-18-30(26)32/h1-18,31-34H,19-22H2,(H,39,45)(H,40,46)(H,41,42)(H,43,44)/t33-,34-/m0/s1 |
| InChIKey | BSTFLVJAPLHIRT-HEVIKAOCSA-N |
| XLogP | 6.31 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.70 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|