C18H19N3O4 — CID 175987234
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydrazinylpropanoic acid (PubChem CID 175987234) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydrazinylpropanoic acid.
| Compound Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydrazinylpropanoic acid |
|---|---|
| PubChem CID | 175987234 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydrazinylpropanoic acid |
| SMILES | NNC[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C18H19N3O4/c19-20-9-16(17(22)23)21-18(24)25-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16,20H,9-10,19H2,(H,21,24)(H,22,23)/t16-/m1/s1 |
| InChIKey | OSJHPWYAFAXHGJ-MRXNPFEDSA-N |
| XLogP | 1.44 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|