C21H25N3O6 — CID 91412337
(2S)-3-acetamido-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid;O-methylhydroxylamine (PubChem CID 91412337) has the molecular formula C21H25N3O6 and a molecular weight of 415.45 g/mol. Its IUPAC name is (2S)-3-acetamido-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid;O-methylhydroxylamine.
| Compound Name | (2S)-3-acetamido-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid;O-methylhydroxylamine |
|---|---|
| PubChem CID | 91412337 |
| Molecular Formula | C21H25N3O6 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | (2S)-3-acetamido-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid;O-methylhydroxylamine |
| SMILES | CC(=O)NC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O.CON |
| InChI | InChI=1S/C20H20N2O5.CH5NO/c1-12(23)21-10-18(19(24)25)22-20(26)27-11-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17;1-3-2/h2-9,17-18H,10-11H2,1H3,(H,21,23)(H,22,26)(H,24,25);2H2,1H3/t18-;/m0./s1 |
| InChIKey | HGROZXIUVDSUAB-FERBBOLQSA-N |
| XLogP | 1.62 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|