C21H26N2O5 — CID 91143180
2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid;N-methoxymethanamine (PubChem CID 91143180) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid;N-methoxymethanamine.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid;N-methoxymethanamine |
|---|---|
| PubChem CID | 91143180 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid;N-methoxymethanamine |
| SMILES | CCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O.CNOC |
| InChI | InChI=1S/C19H19NO4.C2H7NO/c1-2-17(18(21)22)20-19(23)24-11-16-14-9-5-3-7-12(14)13-8-4-6-10-15(13)16;1-3-4-2/h3-10,16-17H,2,11H2,1H3,(H,20,23)(H,21,22);3H,1-2H3 |
| InChIKey | BEFKKUWXPLOECP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|