C23H26N2O6 — CID 165483755
2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoyl]amino]-4-hydroxybutanoic acid (PubChem CID 165483755) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoyl]amino]-4-hydroxybutanoic acid.
| Compound Name | 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoyl]amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 165483755 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoyl]amino]-4-hydroxybutanoic acid |
| SMILES | CC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NC(CCO)C(=O)O |
| InChI | InChI=1S/C23H26N2O6/c1-2-19(21(27)24-20(11-12-26)22(28)29)25-23(30)31-13-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,18-20,26H,2,11-13H2,1H3,(H,24,27)(H,25,30)(H,28,29)/t19-,20?/m0/s1 |
| InChIKey | FZZSMHFTBNLULP-XJDOXCRVSA-N |
| XLogP | 2.26 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |