C22H21NO7 — CID 143400713
2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-methoxy-4,6-dioxohexanoic acid (PubChem CID 143400713) has the molecular formula C22H21NO7 and a molecular weight of 411.41 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-methoxy-4,6-dioxohexanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-methoxy-4,6-dioxohexanoic acid |
|---|---|
| PubChem CID | 143400713 |
| Molecular Formula | C22H21NO7 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-methoxy-4,6-dioxohexanoic acid |
| SMILES | COC(=O)CC(=O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C22H21NO7/c1-29-20(25)11-13(24)10-19(21(26)27)23-22(28)30-12-18-16-8-4-2-6-14(16)15-7-3-5-9-17(15)18/h2-9,18-19H,10-12H2,1H3,(H,23,28)(H,26,27) |
| InChIKey | PPQHQHOMSYGFHH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|