C29H32N2O8S — CID 118981726
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(3S)-4-oxo-4-prop-2-enoxy-3-(prop-2-enoxycarbonylamino)butyl]sulfanylpropanoic acid (PubChem CID 118981726) has the molecular formula C29H32N2O8S and a molecular weight of 568.65 g/mol. Its IUPAC name is (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(3S)-4-oxo-4-prop-2-enoxy-3-(prop-2-enoxycarbonylamino)butyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(3S)-4-oxo-4-prop-2-enoxy-3-(prop-2-enoxycarbonylamino)butyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 118981726 |
| Molecular Formula | C29H32N2O8S |
| Molecular Weight | 568.65 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(3S)-4-oxo-4-prop-2-enoxy-3-(prop-2-enoxycarbonylamino)butyl]sulfanylpropanoic acid |
| SMILES | C=CCOC(=O)N[C@@H](CCSC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)C(=O)OCC=C |
| InChI | InChI=1S/C29H32N2O8S/c1-3-14-37-27(34)24(30-28(35)38-15-4-2)13-16-40-18-25(26(32)33)31-29(36)39-17-23-21-11-7-5-9-19(21)20-10-6-8-12-22(20)23/h3-12,23-25H,1-2,13-18H2,(H,30,35)(H,31,36)(H,32,33)/t24-,25-/m0/s1 |
| InChIKey | PWAQOWOEVIESES-DQEYMECFSA-N |
| XLogP | 4.11 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.65 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|