C23H27NO5S — CID 118145911
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-hydroxypentylsulfanyl)propanoic acid (PubChem CID 118145911) has the molecular formula C23H27NO5S and a molecular weight of 429.54 g/mol. Its IUPAC name is (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-hydroxypentylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-hydroxypentylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 118145911 |
| Molecular Formula | C23H27NO5S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-hydroxypentylsulfanyl)propanoic acid |
| SMILES | O=C(N[C@@H](CSCCCCCO)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C23H27NO5S/c25-12-6-1-7-13-30-15-21(22(26)27)24-23(28)29-14-20-18-10-4-2-8-16(18)17-9-3-5-11-19(17)20/h2-5,8-11,20-21,25H,1,6-7,12-15H2,(H,24,28)(H,26,27)/t21-/m0/s1 |
| InChIKey | WIJFBDSQVFHTAX-NRFANRHFSA-N |
| XLogP | 3.87 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|