C30H39NO6S — CID 155271432
3-(2-decanoyloxyethylsulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (PubChem CID 155271432) has the molecular formula C30H39NO6S and a molecular weight of 541.71 g/mol. Its IUPAC name is 3-(2-decanoyloxyethylsulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-(2-decanoyloxyethylsulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 155271432 |
| Molecular Formula | C30H39NO6S |
| Molecular Weight | 541.71 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | 3-(2-decanoyloxyethylsulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| SMILES | CCCCCCCCCC(=O)OCCSCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C30H39NO6S/c1-2-3-4-5-6-7-8-17-28(32)36-18-19-38-21-27(29(33)34)31-30(35)37-20-26-24-15-11-9-13-22(24)23-14-10-12-16-25(23)26/h9-16,26-27H,2-8,17-21H2,1H3,(H,31,35)(H,33,34) |
| InChIKey | URQAQTXBPIUBKV-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.71 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|