C28H31NO7S — CID 161228927
4-(9H-fluoren-9-ylmethoxy)-4-oxo-2-[[4-oxo-3-(prop-2-enoxycarbonylamino)pentyl]sulfanylmethyl]butanoic acid (PubChem CID 161228927) has the molecular formula C28H31NO7S and a molecular weight of 525.62 g/mol. Its IUPAC name is 4-(9H-fluoren-9-ylmethoxy)-4-oxo-2-[[4-oxo-3-(prop-2-enoxycarbonylamino)pentyl]sulfanylmethyl]butanoic acid.
| Compound Name | 4-(9H-fluoren-9-ylmethoxy)-4-oxo-2-[[4-oxo-3-(prop-2-enoxycarbonylamino)pentyl]sulfanylmethyl]butanoic acid |
|---|---|
| PubChem CID | 161228927 |
| Molecular Formula | C28H31NO7S |
| Molecular Weight | 525.62 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | 4-(9H-fluoren-9-ylmethoxy)-4-oxo-2-[[4-oxo-3-(prop-2-enoxycarbonylamino)pentyl]sulfanylmethyl]butanoic acid |
| SMILES | C=CCOC(=O)NC(CCSCC(CC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)C(C)=O |
| InChI | InChI=1S/C28H31NO7S/c1-3-13-35-28(34)29-25(18(2)30)12-14-37-17-19(27(32)33)15-26(31)36-16-24-22-10-6-4-8-20(22)21-9-5-7-11-23(21)24/h3-11,19,24-25H,1,12-17H2,2H3,(H,29,34)(H,32,33) |
| InChIKey | ROBDCOJRZSPHOK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.62 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|