C26H27NO6 — CID 102479998
bis(prop-2-enyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioate (PubChem CID 102479998) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is bis(prop-2-enyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioate.
| Compound Name | bis(prop-2-enyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioate |
|---|---|
| PubChem CID | 102479998 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | bis(prop-2-enyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioate |
| SMILES | C=CCOC(=O)CC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCC=C |
| InChI | InChI=1S/C26H27NO6/c1-3-15-31-24(28)14-13-23(25(29)32-16-4-2)27-26(30)33-17-22-20-11-7-5-9-18(20)19-10-6-8-12-21(19)22/h3-12,22-23H,1-2,13-17H2,(H,27,30)/t23-/m0/s1 |
| InChIKey | GFNFHJUQNKFHRJ-QHCPKHFHSA-N |
| XLogP | 4.13 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|