C28H27NO5 — CID 102532078
prop-2-enyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methoxyphenyl)propanoate (PubChem CID 102532078) has the molecular formula C28H27NO5 and a molecular weight of 457.53 g/mol. Its IUPAC name is prop-2-enyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methoxyphenyl)propanoate.
| Compound Name | prop-2-enyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 102532078 |
| Molecular Formula | C28H27NO5 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | prop-2-enyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methoxyphenyl)propanoate |
| SMILES | C=CCOC(=O)[C@H](Cc1ccc(OC)cc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H27NO5/c1-3-16-33-27(30)26(17-19-12-14-20(32-2)15-13-19)29-28(31)34-18-25-23-10-6-4-8-21(23)22-9-5-7-11-24(22)25/h3-15,25-26H,1,16-18H2,2H3,(H,29,31)/t26-/m0/s1 |
| InChIKey | QAODQEHQEMOPTL-SANMLTNESA-N |
| XLogP | 4.87 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|