C34H40ClN3O6 — CID 11983500
methyl (2S)-2-[[(2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoyl]amino]-3-(4-prop-2-enoxyphenyl)propanoate;hydrochloride (PubChem CID 11983500) has the molecular formula C34H40ClN3O6 and a molecular weight of 622.16 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoyl]amino]-3-(4-prop-2-enoxyphenyl)propanoate;hydrochloride.
| Compound Name | methyl (2S)-2-[[(2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoyl]amino]-3-(4-prop-2-enoxyphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 11983500 |
| Molecular Formula | C34H40ClN3O6 |
| Molecular Weight | 622.16 g/mol |
| Exact Mass | 621.26 |
| IUPAC Name | methyl (2S)-2-[[(2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoyl]amino]-3-(4-prop-2-enoxyphenyl)propanoate;hydrochloride |
| SMILES | C=CCOc1ccc(C[C@H](NC(=O)[C@H](CCCCN)NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)OC)cc1.Cl |
| InChI | InChI=1S/C34H39N3O6.ClH/c1-3-20-42-24-17-15-23(16-18-24)21-31(33(39)41-2)36-32(38)30(14-8-9-19-35)37-34(40)43-22-29-27-12-6-4-10-25(27)26-11-5-7-13-28(26)29;/h3-7,10-13,15-18,29-31H,1,8-9,14,19-22,35H2,2H3,(H,36,38)(H,37,40);1H/t30-,31-;/m0./s1 |
| InChIKey | ANUVMHIEKXXFAB-PNXDLZEOSA-N |
| XLogP | 4.91 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.16 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|