C32H43ClN4O7 — CID 68625164
(2S)-2-[[(2R)-2-[[(2S)-2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-6-aminohexanoyl]amino]-3-(4-prop-2-enoxyphenyl)propanoic acid;hydrochloride (PubChem CID 68625164) has the molecular formula C32H43ClN4O7 and a molecular weight of 631.17 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-[[(2S)-2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-6-aminohexanoyl]amino]-3-(4-prop-2-enoxyphenyl)propanoic acid;hydrochloride.
| Compound Name | (2S)-2-[[(2R)-2-[[(2S)-2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-6-aminohexanoyl]amino]-3-(4-prop-2-enoxyphenyl)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 68625164 |
| Molecular Formula | C32H43ClN4O7 |
| Molecular Weight | 631.17 g/mol |
| Exact Mass | 630.28 |
| IUPAC Name | (2S)-2-[[(2R)-2-[[(2S)-2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-6-aminohexanoyl]amino]-3-(4-prop-2-enoxyphenyl)propanoic acid;hydrochloride |
| SMILES | C=CCOc1ccc(C[C@H](NC(=O)[C@@H](CCCCN)NC(=O)[C@H](Cc2ccc(OCC=C)cc2)NC(C)=O)C(=O)O)cc1.Cl |
| InChI | InChI=1S/C32H42N4O7.ClH/c1-4-18-42-25-13-9-23(10-14-25)20-28(34-22(3)37)31(39)35-27(8-6-7-17-33)30(38)36-29(32(40)41)21-24-11-15-26(16-12-24)43-19-5-2;/h4-5,9-16,27-29H,1-2,6-8,17-21,33H2,3H3,(H,34,37)(H,35,39)(H,36,38)(H,40,41);1H/t27-,28+,29+;/m1./s1 |
| InChIKey | SKSRKXCYNJBORU-BYDHVZBUSA-N |
| XLogP | 2.71 |
| TPSA | 169.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.17 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|