C28H42N6O6 — CID 11983636
methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-7-(diaminomethylideneamino)heptanoyl]amino]pent-4-enoate (PubChem CID 11983636) has the molecular formula C28H42N6O6 and a molecular weight of 558.68 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-7-(diaminomethylideneamino)heptanoyl]amino]pent-4-enoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-7-(diaminomethylideneamino)heptanoyl]amino]pent-4-enoate |
|---|---|
| PubChem CID | 11983636 |
| Molecular Formula | C28H42N6O6 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-7-(diaminomethylideneamino)heptanoyl]amino]pent-4-enoate |
| SMILES | C=CCOc1ccc(C[C@H](NC(C)=O)C(=O)N[C@@H](CCCCCN=C(N)N)C(=O)N[C@@H](CC=C)C(=O)OC)cc1 |
| InChI | InChI=1S/C28H42N6O6/c1-5-10-23(27(38)39-4)34-25(36)22(11-8-7-9-16-31-28(29)30)33-26(37)24(32-19(3)35)18-20-12-14-21(15-13-20)40-17-6-2/h5-6,12-15,22-24H,1-2,7-11,16-18H2,3-4H3,(H,32,35)(H,33,37)(H,34,36)(H4,29,30,31)/t22-,23-,24-/m0/s1 |
| InChIKey | OBOCZXTXDQVVRS-HJOGWXRNSA-N |
| XLogP | 0.85 |
| TPSA | 187.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|