C27H39ClN6O6 — CID 152943607
methyl (2R)-2-[[(2R)-2-[[(2S)-2-acetamido-3-(2-methyl-4-prop-2-enoxyphenyl)propanoyl]amino]-5-[[amino-(chloroamino)methylidene]amino]pentanoyl]amino]pent-4-enoate (PubChem CID 152943607) has the molecular formula C27H39ClN6O6 and a molecular weight of 579.10 g/mol. Its IUPAC name is methyl (2R)-2-[[(2R)-2-[[(2S)-2-acetamido-3-(2-methyl-4-prop-2-enoxyphenyl)propanoyl]amino]-5-[[amino-(chloroamino)methylidene]amino]pentanoyl]amino]pent-4-enoate.
| Compound Name | methyl (2R)-2-[[(2R)-2-[[(2S)-2-acetamido-3-(2-methyl-4-prop-2-enoxyphenyl)propanoyl]amino]-5-[[amino-(chloroamino)methylidene]amino]pentanoyl]amino]pent-4-enoate |
|---|---|
| PubChem CID | 152943607 |
| Molecular Formula | C27H39ClN6O6 |
| Molecular Weight | 579.10 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | methyl (2R)-2-[[(2R)-2-[[(2S)-2-acetamido-3-(2-methyl-4-prop-2-enoxyphenyl)propanoyl]amino]-5-[[amino-(chloroamino)methylidene]amino]pentanoyl]amino]pent-4-enoate |
| SMILES | C=CCOc1ccc(C[C@H](NC(C)=O)C(=O)N[C@H](CCC/N=C(\N)NCl)C(=O)N[C@H](CC=C)C(=O)OC)c(C)c1 |
| InChI | InChI=1S/C27H39ClN6O6/c1-6-9-22(26(38)39-5)33-24(36)21(10-8-13-30-27(29)34-28)32-25(37)23(31-18(4)35)16-19-11-12-20(15-17(19)3)40-14-7-2/h6-7,11-12,15,21-23H,1-2,8-10,13-14,16H2,3-5H3,(H,31,35)(H,32,37)(H,33,36)(H3,29,30,34)/t21-,22-,23+/m1/s1 |
| InChIKey | UNHSTPWBDIFKLL-ZLNRFVROSA-N |
| XLogP | 1.16 |
| TPSA | 173.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.10 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|