C25H35N3O6 — CID 155436628
2-[[2-[[2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-4-methylpentanoyl]amino]pent-4-enoic acid (PubChem CID 155436628) has the molecular formula C25H35N3O6 and a molecular weight of 473.57 g/mol. Its IUPAC name is 2-[[2-[[2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-4-methylpentanoyl]amino]pent-4-enoic acid.
| Compound Name | 2-[[2-[[2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-4-methylpentanoyl]amino]pent-4-enoic acid |
|---|---|
| PubChem CID | 155436628 |
| Molecular Formula | C25H35N3O6 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | 2-[[2-[[2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-4-methylpentanoyl]amino]pent-4-enoic acid |
| SMILES | C=CCOc1ccc(CC(NC(C)=O)C(=O)NC(CC(C)C)C(=O)NC(CC=C)C(=O)O)cc1 |
| InChI | InChI=1S/C25H35N3O6/c1-6-8-20(25(32)33)27-23(30)21(14-16(3)4)28-24(31)22(26-17(5)29)15-18-9-11-19(12-10-18)34-13-7-2/h6-7,9-12,16,20-22H,1-2,8,13-15H2,3-5H3,(H,26,29)(H,27,30)(H,28,31)(H,32,33) |
| InChIKey | QTPSUOQMSFOQGA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|