C33H45ClN4O7 — CID 11983521
methyl (2S)-2-[[(2R)-2-[[(2S)-2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-6-aminohexanoyl]amino]-3-(4-prop-2-enoxyphenyl)propanoate;hydrochloride (PubChem CID 11983521) has the molecular formula C33H45ClN4O7 and a molecular weight of 645.20 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R)-2-[[(2S)-2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-6-aminohexanoyl]amino]-3-(4-prop-2-enoxyphenyl)propanoate;hydrochloride.
| Compound Name | methyl (2S)-2-[[(2R)-2-[[(2S)-2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-6-aminohexanoyl]amino]-3-(4-prop-2-enoxyphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 11983521 |
| Molecular Formula | C33H45ClN4O7 |
| Molecular Weight | 645.20 g/mol |
| Exact Mass | 644.30 |
| IUPAC Name | methyl (2S)-2-[[(2R)-2-[[(2S)-2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-6-aminohexanoyl]amino]-3-(4-prop-2-enoxyphenyl)propanoate;hydrochloride |
| SMILES | C=CCOc1ccc(C[C@H](NC(C)=O)C(=O)N[C@H](CCCCN)C(=O)N[C@@H](Cc2ccc(OCC=C)cc2)C(=O)OC)cc1.Cl |
| InChI | InChI=1S/C33H44N4O7.ClH/c1-5-19-43-26-14-10-24(11-15-26)21-29(35-23(3)38)32(40)36-28(9-7-8-18-34)31(39)37-30(33(41)42-4)22-25-12-16-27(17-13-25)44-20-6-2;/h5-6,10-17,28-30H,1-2,7-9,18-22,34H2,3-4H3,(H,35,38)(H,36,40)(H,37,39);1H/t28-,29+,30+;/m1./s1 |
| InChIKey | POLCKTWSEMOJRF-MYMWKKEBSA-N |
| XLogP | 2.80 |
| TPSA | 158.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.20 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|