C21H30N2O5 — CID 155749289
methyl (2S)-2-[[(2S)-2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-4-methylpentanoate (PubChem CID 155749289) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 155749289 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-4-methylpentanoate |
| SMILES | C=CCOc1ccc(C[C@H](NC(C)=O)C(=O)N[C@@H](CC(C)C)C(=O)OC)cc1 |
| InChI | InChI=1S/C21H30N2O5/c1-6-11-28-17-9-7-16(8-10-17)13-18(22-15(4)24)20(25)23-19(12-14(2)3)21(26)27-5/h6-10,14,18-19H,1,11-13H2,2-5H3,(H,22,24)(H,23,25)/t18-,19-/m0/s1 |
| InChIKey | BESZKOQUWOJROJ-OALUTQOASA-N |
| XLogP | 2.00 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|