C21H29BN2O5 — CID 90277094
CID 90277094 (PubChem CID 90277094) has the molecular formula C21H29BN2O5 and a molecular weight of 400.28 g/mol.
| Compound Name | CID 90277094 |
|---|---|
| PubChem CID | 90277094 |
| Molecular Formula | C21H29BN2O5 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | — |
| SMILES | [B]O/C=N/[C@@H](Cc1ccc(OCCC=C)cc1)C(=O)N[C@@H](CC(C)C)C(=O)OC |
| InChI | InChI=1S/C21H29BN2O5/c1-5-6-11-28-17-9-7-16(8-10-17)13-18(23-14-29-22)20(25)24-19(12-15(2)3)21(26)27-4/h5,7-10,14-15,18-19H,1,6,11-13H2,2-4H3,(H,24,25)/b23-14+/t18-,19-/m0/s1 |
| InChIKey | WMJGFZFBYWWPTJ-DENSEHQSSA-N |
| XLogP | 2.38 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|