C19H33NO3 — CID 101146041
methyl (2S)-4-methyl-2-(2-pent-4-enylhept-6-enoylamino)pentanoate (PubChem CID 101146041) has the molecular formula C19H33NO3 and a molecular weight of 323.48 g/mol. Its IUPAC name is methyl (2S)-4-methyl-2-(2-pent-4-enylhept-6-enoylamino)pentanoate.
| Compound Name | methyl (2S)-4-methyl-2-(2-pent-4-enylhept-6-enoylamino)pentanoate |
|---|---|
| PubChem CID | 101146041 |
| Molecular Formula | C19H33NO3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.25 |
| IUPAC Name | methyl (2S)-4-methyl-2-(2-pent-4-enylhept-6-enoylamino)pentanoate |
| SMILES | C=CCCCC(CCCC=C)C(=O)N[C@@H](CC(C)C)C(=O)OC |
| InChI | InChI=1S/C19H33NO3/c1-6-8-10-12-16(13-11-9-7-2)18(21)20-17(14-15(3)4)19(22)23-5/h6-7,15-17H,1-2,8-14H2,3-5H3,(H,20,21)/t17-/m0/s1 |
| InChIKey | XTTKLSVUSNOYHQ-KRWDZBQOSA-N |
| XLogP | 4.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|