C10H18N2O3 — CID 90161899
methyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]hex-5-enoate (PubChem CID 90161899) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]hex-5-enoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]hex-5-enoate |
|---|---|
| PubChem CID | 90161899 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]hex-5-enoate |
| SMILES | C=CCC[C@H](NC(=O)[C@H](C)N)C(=O)OC |
| InChI | InChI=1S/C10H18N2O3/c1-4-5-6-8(10(14)15-3)12-9(13)7(2)11/h4,7-8H,1,5-6,11H2,2-3H3,(H,12,13)/t7-,8-/m0/s1 |
| InChIKey | ZBFCZHUZVDTOLP-YUMQZZPRSA-N |
| XLogP | -0.04 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|