C16H28N6O7 — CID 174966771
[5-amino-2-(2-aminopropanoylamino)-5-oxopentanoyl] 5-amino-2-(2-aminopropanoylamino)-5-oxopentanoate (PubChem CID 174966771) has the molecular formula C16H28N6O7 and a molecular weight of 416.44 g/mol. Its IUPAC name is [5-amino-2-(2-aminopropanoylamino)-5-oxopentanoyl] 5-amino-2-(2-aminopropanoylamino)-5-oxopentanoate.
| Compound Name | [5-amino-2-(2-aminopropanoylamino)-5-oxopentanoyl] 5-amino-2-(2-aminopropanoylamino)-5-oxopentanoate |
|---|---|
| PubChem CID | 174966771 |
| Molecular Formula | C16H28N6O7 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | [5-amino-2-(2-aminopropanoylamino)-5-oxopentanoyl] 5-amino-2-(2-aminopropanoylamino)-5-oxopentanoate |
| SMILES | CC(N)C(=O)NC(CCC(N)=O)C(=O)OC(=O)C(CCC(N)=O)NC(=O)C(C)N |
| InChI | InChI=1S/C16H28N6O7/c1-7(17)13(25)21-9(3-5-11(19)23)15(27)29-16(28)10(4-6-12(20)24)22-14(26)8(2)18/h7-10H,3-6,17-18H2,1-2H3,(H2,19,23)(H2,20,24)(H,21,25)(H,22,26) |
| InChIKey | MSBSBGWGMOGGEL-UHFFFAOYSA-N |
| XLogP | -3.75 |
| TPSA | 239.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | -3.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|