C7H14N2O3S — CID 91978262
methyl (2R)-2-[[(2S)-2-aminopropanoyl]amino]-3-sulfanylpropanoate (PubChem CID 91978262) has the molecular formula C7H14N2O3S and a molecular weight of 206.27 g/mol. Its IUPAC name is methyl (2R)-2-[[(2S)-2-aminopropanoyl]amino]-3-sulfanylpropanoate.
| Compound Name | methyl (2R)-2-[[(2S)-2-aminopropanoyl]amino]-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 91978262 |
| Molecular Formula | C7H14N2O3S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | methyl (2R)-2-[[(2S)-2-aminopropanoyl]amino]-3-sulfanylpropanoate |
| SMILES | COC(=O)[C@H](CS)NC(=O)[C@H](C)N |
| InChI | InChI=1S/C7H14N2O3S/c1-4(8)6(10)9-5(3-13)7(11)12-2/h4-5,13H,3,8H2,1-2H3,(H,9,10)/t4-,5-/m0/s1 |
| InChIKey | PJCOIVCUDUGLOX-WHFBIAKZSA-N |
| XLogP | -1.08 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|