C11H20N4O5S2 — CID 18234318
2-[[2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]acetyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18234318) has the molecular formula C11H20N4O5S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-[[2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]acetyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]acetyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18234318 |
| Molecular Formula | C11H20N4O5S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]acetyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(N)C(=O)NC(CS)C(=O)NCC(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C11H20N4O5S2/c1-5(12)9(17)15-6(3-21)10(18)13-2-8(16)14-7(4-22)11(19)20/h5-7,21-22H,2-4,12H2,1H3,(H,13,18)(H,14,16)(H,15,17)(H,19,20) |
| InChIKey | FODWPTGZPBWKOJ-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|