C12H20N4O7S — CID 18234317
2-[[2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]acetyl]amino]butanedioic acid (PubChem CID 18234317) has the molecular formula C12H20N4O7S and a molecular weight of 364.38 g/mol. Its IUPAC name is 2-[[2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]acetyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]acetyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18234317 |
| Molecular Formula | C12H20N4O7S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]acetyl]amino]butanedioic acid |
| SMILES | CC(N)C(=O)NC(CS)C(=O)NCC(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H20N4O7S/c1-5(13)10(20)16-7(4-24)11(21)14-3-8(17)15-6(12(22)23)2-9(18)19/h5-7,24H,2-4,13H2,1H3,(H,14,21)(H,15,17)(H,16,20)(H,18,19)(H,22,23) |
| InChIKey | FTRCRLAGGXCRES-UHFFFAOYSA-N |
| XLogP | -3.09 |
| TPSA | 187.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|