C13H22N4O8 — CID 18239072
2-[[2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]acetyl]amino]butanedioic acid (PubChem CID 18239072) has the molecular formula C13H22N4O8 and a molecular weight of 362.34 g/mol. Its IUPAC name is 2-[[2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]acetyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]acetyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18239072 |
| Molecular Formula | C13H22N4O8 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-hydroxybutanoyl]amino]acetyl]amino]butanedioic acid |
| SMILES | CC(N)C(=O)NC(C(=O)NCC(=O)NC(CC(=O)O)C(=O)O)C(C)O |
| InChI | InChI=1S/C13H22N4O8/c1-5(14)11(22)17-10(6(2)18)12(23)15-4-8(19)16-7(13(24)25)3-9(20)21/h5-7,10,18H,3-4,14H2,1-2H3,(H,15,23)(H,16,19)(H,17,22)(H,20,21)(H,24,25) |
| InChIKey | WVLYYUWATHFZHC-UHFFFAOYSA-N |
| XLogP | -3.64 |
| TPSA | 208.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | -3.64 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |