C16H29N5O8 — CID 18253040
6-amino-2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-hydroxybutanoyl]amino]acetyl]amino]hexanoic acid (PubChem CID 18253040) has the molecular formula C16H29N5O8 and a molecular weight of 419.44 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-hydroxybutanoyl]amino]acetyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-hydroxybutanoyl]amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18253040 |
| Molecular Formula | C16H29N5O8 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-hydroxybutanoyl]amino]acetyl]amino]hexanoic acid |
| SMILES | CC(O)C(NC(=O)C(N)CC(=O)O)C(=O)NCC(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C16H29N5O8/c1-8(22)13(21-14(26)9(18)6-12(24)25)15(27)19-7-11(23)20-10(16(28)29)4-2-3-5-17/h8-10,13,22H,2-7,17-18H2,1H3,(H,19,27)(H,20,23)(H,21,26)(H,24,25)(H,28,29) |
| InChIKey | MLKWVPMRUKGDFJ-UHFFFAOYSA-N |
| XLogP | -3.53 |
| TPSA | 234.17 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | -3.53 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|