C19H37N5O5 — CID 18302082
6-amino-2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-methylbutanoyl]amino]acetyl]amino]hexanoic acid (PubChem CID 18302082) has the molecular formula C19H37N5O5 and a molecular weight of 415.54 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-methylbutanoyl]amino]acetyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-methylbutanoyl]amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18302082 |
| Molecular Formula | C19H37N5O5 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-methylbutanoyl]amino]acetyl]amino]hexanoic acid |
| SMILES | CC(C)CC(N)C(=O)NC(C(=O)NCC(=O)NC(CCCCN)C(=O)O)C(C)C |
| InChI | InChI=1S/C19H37N5O5/c1-11(2)9-13(21)17(26)24-16(12(3)4)18(27)22-10-15(25)23-14(19(28)29)7-5-6-8-20/h11-14,16H,5-10,20-21H2,1-4H3,(H,22,27)(H,23,25)(H,24,26)(H,28,29) |
| InChIKey | UJDJJSJEXVBRMQ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|