C25H49N9O6 — CID 175836462
(2S)-2-[[2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]hexanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 175836462) has the molecular formula C25H49N9O6 and a molecular weight of 571.72 g/mol. Its IUPAC name is (2S)-2-[[2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]hexanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]hexanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 175836462 |
| Molecular Formula | C25H49N9O6 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.38 |
| IUPAC Name | (2S)-2-[[2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]hexanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@H](C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](CCCN=C(N)N)C(=O)O)C(C)C |
| InChI | InChI=1S/C25H49N9O6/c1-14(2)12-16(27)21(36)34-20(15(3)4)23(38)33-17(8-5-6-10-26)22(37)31-13-19(35)32-18(24(39)40)9-7-11-30-25(28)29/h14-18,20H,5-13,26-27H2,1-4H3,(H,31,37)(H,32,35)(H,33,38)(H,34,36)(H,39,40)(H4,28,29,30)/t16-,17-,18-,20-/m0/s1 |
| InChIKey | RBIACKUICOYRIR-JPLJXNOCSA-N |
| XLogP | -2.15 |
| TPSA | 270.14 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|