C22H43N9O6 — CID 175724425
(2S)-6-amino-2-[[2-[[(2S)-2-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-4-methylpentanoyl]amino]acetyl]amino]hexanoic acid (PubChem CID 175724425) has the molecular formula C22H43N9O6 and a molecular weight of 529.64 g/mol. Its IUPAC name is (2S)-6-amino-2-[[2-[[(2S)-2-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-4-methylpentanoyl]amino]acetyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[2-[[(2S)-2-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-4-methylpentanoyl]amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 175724425 |
| Molecular Formula | C22H43N9O6 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.33 |
| IUPAC Name | (2S)-6-amino-2-[[2-[[(2S)-2-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-4-methylpentanoyl]amino]acetyl]amino]hexanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)[C@@H](N)CCCN=C(N)N)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C22H43N9O6/c1-13(2)10-16(20(35)29-12-17(32)30-15(21(36)37)7-3-4-8-23)31-18(33)11-28-19(34)14(24)6-5-9-27-22(25)26/h13-16H,3-12,23-24H2,1-2H3,(H,28,34)(H,29,35)(H,30,32)(H,31,33)(H,36,37)(H4,25,26,27)/t14-,15-,16-/m0/s1 |
| InChIKey | BONDGWWXZGAMKU-JYJNAYRXSA-N |
| XLogP | -3.17 |
| TPSA | 270.14 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|