C19H38N8O4 — CID 170721451
6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-N-(3-methyl-2-oxobutyl)hexanamide (PubChem CID 170721451) has the molecular formula C19H38N8O4 and a molecular weight of 442.57 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-N-(3-methyl-2-oxobutyl)hexanamide.
| Compound Name | 6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-N-(3-methyl-2-oxobutyl)hexanamide |
|---|---|
| PubChem CID | 170721451 |
| Molecular Formula | C19H38N8O4 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.30 |
| IUPAC Name | 6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-N-(3-methyl-2-oxobutyl)hexanamide |
| SMILES | CC(C)C(=O)CNC(=O)C(CCCCN)NC(=O)CNC(=O)C(N)CCCN=C(N)N |
| InChI | InChI=1S/C19H38N8O4/c1-12(2)15(28)10-25-18(31)14(7-3-4-8-20)27-16(29)11-26-17(30)13(21)6-5-9-24-19(22)23/h12-14H,3-11,20-21H2,1-2H3,(H,25,31)(H,26,30)(H,27,29)(H4,22,23,24) |
| InChIKey | LEZXDLDIBZXLDU-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 220.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|