C18H36N8O4 — CID 170721580
6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-N-(2-oxobutyl)hexanamide (PubChem CID 170721580) has the molecular formula C18H36N8O4 and a molecular weight of 428.54 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-N-(2-oxobutyl)hexanamide.
| Compound Name | 6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-N-(2-oxobutyl)hexanamide |
|---|---|
| PubChem CID | 170721580 |
| Molecular Formula | C18H36N8O4 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-N-(2-oxobutyl)hexanamide |
| SMILES | CCC(=O)CNC(=O)C(CCCCN)NC(=O)CNC(=O)C(N)CCCN=C(N)N |
| InChI | InChI=1S/C18H36N8O4/c1-2-12(27)10-24-17(30)14(7-3-4-8-19)26-15(28)11-25-16(29)13(20)6-5-9-23-18(21)22/h13-14H,2-11,19-20H2,1H3,(H,24,30)(H,25,29)(H,26,28)(H4,21,22,23) |
| InChIKey | UHICPBYDCVUQOG-UHFFFAOYSA-N |
| XLogP | -2.81 |
| TPSA | 220.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|