C20H40N6O5 — CID 18306807
2-[[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]acetyl]amino]-4-methylpentanoic acid (PubChem CID 18306807) has the molecular formula C20H40N6O5 and a molecular weight of 444.58 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]acetyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 18306807 |
| Molecular Formula | C20H40N6O5 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | 2-[[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]acetyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)CNC(=O)C(CCCCN)NC(=O)C(N)CCCCN)C(=O)O |
| InChI | InChI=1S/C20H40N6O5/c1-13(2)11-16(20(30)31)25-17(27)12-24-19(29)15(8-4-6-10-22)26-18(28)14(23)7-3-5-9-21/h13-16H,3-12,21-23H2,1-2H3,(H,24,29)(H,25,27)(H,26,28)(H,30,31) |
| InChIKey | YCINENPXDAHZLF-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 202.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|