C16H31N5O5 — CID 18489219
2-[[2-[[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]acetyl]amino]-4-methylpentanoic acid (PubChem CID 18489219) has the molecular formula C16H31N5O5 and a molecular weight of 373.45 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]acetyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 18489219 |
| Molecular Formula | C16H31N5O5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]acetyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)CNC(=O)C(CCCCN)NC(=O)CN)C(=O)O |
| InChI | InChI=1S/C16H31N5O5/c1-10(2)7-12(16(25)26)21-14(23)9-19-15(24)11(5-3-4-6-17)20-13(22)8-18/h10-12H,3-9,17-18H2,1-2H3,(H,19,24)(H,20,22)(H,21,23)(H,25,26) |
| InChIKey | ZITOUNHMSFZLSS-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|