C16H30N4O5 — CID 88862190
(2S)-2-[[2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]acetyl]amino]-6-aminohexanoic acid (PubChem CID 88862190) has the molecular formula C16H30N4O5 and a molecular weight of 358.44 g/mol. Its IUPAC name is (2S)-2-[[2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]acetyl]amino]-6-aminohexanoic acid.
| Compound Name | (2S)-2-[[2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]acetyl]amino]-6-aminohexanoic acid |
|---|---|
| PubChem CID | 88862190 |
| Molecular Formula | C16H30N4O5 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | (2S)-2-[[2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]acetyl]amino]-6-aminohexanoic acid |
| SMILES | CC(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C16H30N4O5/c1-10(2)8-13(19-11(3)21)15(23)18-9-14(22)20-12(16(24)25)6-4-5-7-17/h10,12-13H,4-9,17H2,1-3H3,(H,18,23)(H,19,21)(H,20,22)(H,24,25)/t12-,13-/m0/s1 |
| InChIKey | FSRYUJSJBNYSNS-STQMWFEESA-N |
| XLogP | -0.65 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|