C18H34N6O6 — CID 18489121
2-[[4-amino-2-[[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]-4-oxobutanoyl]amino]-4-methylpentanoic acid (PubChem CID 18489121) has the molecular formula C18H34N6O6 and a molecular weight of 430.51 g/mol. Its IUPAC name is 2-[[4-amino-2-[[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]-4-oxobutanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[4-amino-2-[[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]-4-oxobutanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 18489121 |
| Molecular Formula | C18H34N6O6 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 2-[[4-amino-2-[[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]-4-oxobutanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(CC(N)=O)NC(=O)C(CCCCN)NC(=O)CN)C(=O)O |
| InChI | InChI=1S/C18H34N6O6/c1-10(2)7-13(18(29)30)24-17(28)12(8-14(21)25)23-16(27)11(5-3-4-6-19)22-15(26)9-20/h10-13H,3-9,19-20H2,1-2H3,(H2,21,25)(H,22,26)(H,23,27)(H,24,28)(H,29,30) |
| InChIKey | VOYQISNQEOPCST-UHFFFAOYSA-N |
| XLogP | -2.47 |
| TPSA | 219.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|