C16H29N7O7 — CID 18489113
4-amino-2-[[4-amino-2-[[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]-4-oxobutanoyl]amino]-4-oxobutanoic acid (PubChem CID 18489113) has the molecular formula C16H29N7O7 and a molecular weight of 431.45 g/mol. Its IUPAC name is 4-amino-2-[[4-amino-2-[[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]-4-oxobutanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[4-amino-2-[[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]-4-oxobutanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18489113 |
| Molecular Formula | C16H29N7O7 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 4-amino-2-[[4-amino-2-[[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]-4-oxobutanoyl]amino]-4-oxobutanoic acid |
| SMILES | NCCCCC(NC(=O)CN)C(=O)NC(CC(N)=O)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C16H29N7O7/c17-4-2-1-3-8(21-13(26)7-18)14(27)22-9(5-11(19)24)15(28)23-10(16(29)30)6-12(20)25/h8-10H,1-7,17-18H2,(H2,19,24)(H2,20,25)(H,21,26)(H,22,27)(H,23,28)(H,29,30) |
| InChIKey | QKEQUWULZBKJOZ-UHFFFAOYSA-N |
| XLogP | -4.64 |
| TPSA | 262.82 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | -4.64 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|