C11H19N5O6 — CID 18221001
4-amino-2-[[5-amino-2-[(2-aminoacetyl)amino]-5-oxopentanoyl]amino]-4-oxobutanoic acid (PubChem CID 18221001) has the molecular formula C11H19N5O6 and a molecular weight of 317.30 g/mol. Its IUPAC name is 4-amino-2-[[5-amino-2-[(2-aminoacetyl)amino]-5-oxopentanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[5-amino-2-[(2-aminoacetyl)amino]-5-oxopentanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18221001 |
| Molecular Formula | C11H19N5O6 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 4-amino-2-[[5-amino-2-[(2-aminoacetyl)amino]-5-oxopentanoyl]amino]-4-oxobutanoic acid |
| SMILES | NCC(=O)NC(CCC(N)=O)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C11H19N5O6/c12-4-9(19)15-5(1-2-7(13)17)10(20)16-6(11(21)22)3-8(14)18/h5-6H,1-4,12H2,(H2,13,17)(H2,14,18)(H,15,19)(H,16,20)(H,21,22) |
| InChIKey | BULIVUZUDBHKKZ-UHFFFAOYSA-N |
| XLogP | -3.86 |
| TPSA | 207.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | -3.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |