C13H25N5O5 — CID 145455653
(2S)-5-amino-2-[[(2S)-6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]-5-oxopentanoic acid (PubChem CID 145455653) has the molecular formula C13H25N5O5 and a molecular weight of 331.37 g/mol. Its IUPAC name is (2S)-5-amino-2-[[(2S)-6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[[(2S)-6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 145455653 |
| Molecular Formula | C13H25N5O5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | (2S)-5-amino-2-[[(2S)-6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]-5-oxopentanoic acid |
| SMILES | NCCCC[C@H](NC(=O)CN)C(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C13H25N5O5/c14-6-2-1-3-8(17-11(20)7-15)12(21)18-9(13(22)23)4-5-10(16)19/h8-9H,1-7,14-15H2,(H2,16,19)(H,17,20)(H,18,21)(H,22,23)/t8-,9-/m0/s1 |
| InChIKey | FHQRLHFYVZAQHU-IUCAKERBSA-N |
| XLogP | -2.61 |
| TPSA | 190.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|