C11H22N4O5 — CID 18221080
2-[[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 18221080) has the molecular formula C11H22N4O5 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-[[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18221080 |
| Molecular Formula | C11H22N4O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 2-[[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | NCCCCC(NC(=O)CN)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C11H22N4O5/c12-4-2-1-3-7(14-9(17)5-13)10(18)15-8(6-16)11(19)20/h7-8,16H,1-6,12-13H2,(H,14,17)(H,15,18)(H,19,20) |
| InChIKey | NTBOEZICHOSJEE-UHFFFAOYSA-N |
| XLogP | -2.88 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|