C15H29N5O7 — CID 18491270
2-[[6-amino-2-[[2-[(2-aminoacetyl)amino]-3-hydroxybutanoyl]amino]hexanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 18491270) has the molecular formula C15H29N5O7 and a molecular weight of 391.43 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2-aminoacetyl)amino]-3-hydroxybutanoyl]amino]hexanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2-aminoacetyl)amino]-3-hydroxybutanoyl]amino]hexanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18491270 |
| Molecular Formula | C15H29N5O7 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2-aminoacetyl)amino]-3-hydroxybutanoyl]amino]hexanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | CC(O)C(NC(=O)CN)C(=O)NC(CCCCN)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C15H29N5O7/c1-8(22)12(20-11(23)6-17)14(25)18-9(4-2-3-5-16)13(24)19-10(7-21)15(26)27/h8-10,12,21-22H,2-7,16-17H2,1H3,(H,18,25)(H,19,24)(H,20,23)(H,26,27) |
| InChIKey | WYGSTEIWFQLYQC-UHFFFAOYSA-N |
| XLogP | -4.01 |
| TPSA | 217.10 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | -4.01 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|