C8H15N3O6 — CID 18221139
2-[[2-[(2-aminoacetyl)amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 18221139) has the molecular formula C8H15N3O6 and a molecular weight of 249.22 g/mol. Its IUPAC name is 2-[[2-[(2-aminoacetyl)amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-[(2-aminoacetyl)amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18221139 |
| Molecular Formula | C8H15N3O6 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-[[2-[(2-aminoacetyl)amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | NCC(=O)NC(CO)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C8H15N3O6/c9-1-6(14)10-4(2-12)7(15)11-5(3-13)8(16)17/h4-5,12-13H,1-3,9H2,(H,10,14)(H,11,15)(H,16,17) |
| InChIKey | WCORRBXVISTKQL-UHFFFAOYSA-N |
| XLogP | -4.02 |
| TPSA | 161.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | -4.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |