C12H24N4O6 — CID 145457816
(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]hexanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 145457816) has the molecular formula C12H24N4O6 and a molecular weight of 320.35 g/mol. Its IUPAC name is (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]hexanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]hexanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 145457816 |
| Molecular Formula | C12H24N4O6 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]hexanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@@H](N)CO)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C12H24N4O6/c13-4-2-1-3-8(15-10(19)7(14)5-17)11(20)16-9(6-18)12(21)22/h7-9,17-18H,1-6,13-14H2,(H,15,19)(H,16,20)(H,21,22)/t7-,8-,9-/m0/s1 |
| InChIKey | FPCGZYMRFFIYIH-CIUDSAMLSA-N |
| XLogP | -3.52 |
| TPSA | 188.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | -3.52 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|