C17H31N5O9 — CID 18743325
2-[[6-amino-2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-hydroxypropanoyl]amino]hexanoyl]amino]pentanedioic acid (PubChem CID 18743325) has the molecular formula C17H31N5O9 and a molecular weight of 449.46 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-hydroxypropanoyl]amino]hexanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-hydroxypropanoyl]amino]hexanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18743325 |
| Molecular Formula | C17H31N5O9 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-hydroxypropanoyl]amino]hexanoyl]amino]pentanedioic acid |
| SMILES | NCCCCC(NC(=O)C(CO)NC(=O)C(N)CO)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H31N5O9/c18-6-2-1-3-10(15(28)21-11(17(30)31)4-5-13(25)26)20-16(29)12(8-24)22-14(27)9(19)7-23/h9-12,23-24H,1-8,18-19H2,(H,20,29)(H,21,28)(H,22,27)(H,25,26)(H,30,31) |
| InChIKey | SZZCDIRSYMSQIW-UHFFFAOYSA-N |
| XLogP | -4.17 |
| TPSA | 254.40 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | -4.17 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|