C13H25N5O5S — CID 18486486
6-amino-2-[[2-[[2-[(2-aminoacetyl)amino]-3-sulfanylpropanoyl]amino]acetyl]amino]hexanoic acid (PubChem CID 18486486) has the molecular formula C13H25N5O5S and a molecular weight of 363.44 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-aminoacetyl)amino]-3-sulfanylpropanoyl]amino]acetyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2-aminoacetyl)amino]-3-sulfanylpropanoyl]amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18486486 |
| Molecular Formula | C13H25N5O5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-aminoacetyl)amino]-3-sulfanylpropanoyl]amino]acetyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)CNC(=O)C(CS)NC(=O)CN)C(=O)O |
| InChI | InChI=1S/C13H25N5O5S/c14-4-2-1-3-8(13(22)23)17-11(20)6-16-12(21)9(7-24)18-10(19)5-15/h8-9,24H,1-7,14-15H2,(H,16,21)(H,17,20)(H,18,19)(H,22,23) |
| InChIKey | POFULFUVRPHJNV-UHFFFAOYSA-N |
| XLogP | -2.83 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|