C11H20N4O6S — CID 18491179
2-[[2-[[2-[(2-aminoacetyl)amino]-3-hydroxybutanoyl]amino]acetyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18491179) has the molecular formula C11H20N4O6S and a molecular weight of 336.37 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-aminoacetyl)amino]-3-hydroxybutanoyl]amino]acetyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-3-hydroxybutanoyl]amino]acetyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18491179 |
| Molecular Formula | C11H20N4O6S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-3-hydroxybutanoyl]amino]acetyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(O)C(NC(=O)CN)C(=O)NCC(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C11H20N4O6S/c1-5(16)9(15-7(17)2-12)10(19)13-3-8(18)14-6(4-22)11(20)21/h5-6,9,16,22H,2-4,12H2,1H3,(H,13,19)(H,14,18)(H,15,17)(H,20,21) |
| InChIKey | DXRUXWIUMMRIDO-UHFFFAOYSA-N |
| XLogP | -3.57 |
| TPSA | 170.85 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|